Difference between revisions of "CPD-3188"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12123 RXN-12123] == * direction: ** left-to-right * common-name: ** soladodine glucosyltransfer...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * smiles: ** c(op([o-])...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12123 RXN-12123] ==
+
== Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** soladodine glucosyltransferase
+
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.4.1.173 ec-2.4.1.173]
+
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-12575]][c] '''+''' 1 [[CPD-13080]][c] '''=>''' 1 [[CPD-13081]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
** xfvulmdjzxymsg-ziyngmlesa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11713]]
+
** 336.174
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AIRCARBOXY-RXN]]
== Pathway(s) ==
+
* [[SAICARSYN-RXN]]
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AIRCARBOXY-RXN]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
{{#set: direction=left-to-right}}
+
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
{{#set: common-name=soladodine glucosyltransferase}}
+
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
{{#set: ec-number=ec-2.4.1.173}}
+
{{#set: molecular-weight=336.174}}
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE

  • common-name:
    • 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
  • inchi-key:
    • xfvulmdjzxymsg-ziyngmlesa-k
  • molecular-weight:
    • 336.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality