Difference between revisions of "CPD-321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-14900 == * common-name: ** porifersta-5,7-dienol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17050 ==
+
== Metabolite CPD-14900 ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** porifersta-5,7-dienol
 
* smiles:
 
* smiles:
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** poiijaagmgnxlo-vxgbxaggsa-n
+
** arvgmiswlzpbch-wgdhxtrrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 296.358
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15684]]
+
* [[RXN-13892]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=porifersta-5,7-dienol}}
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=arvgmiswlzpbch-wgdhxtrrsa-n}}
{{#set: molecular-weight=296.358}}
+
{{#set: molecular-weight=412.698}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-14900

  • common-name:
    • porifersta-5,7-dienol
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • arvgmiswlzpbch-wgdhxtrrsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality