Difference between revisions of "CPD-330"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05160 == * transcription-direction: ** positive * right-end-position: ** 80726 * left-end-position: ** 65078 * centisome-position: ** 12.974368...") |
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite EDTA == |
− | * | + | * common-name: |
− | ** | + | ** edta |
− | * | + | * smiles: |
− | + | ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o | |
− | + | * inchi-key: | |
− | ** | + | ** kcxvzyzypllwcc-uhfffaoysa-l |
− | + | * molecular-weight: | |
− | + | ** 290.229 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[ExchangeSeed-EDTA]] | |
− | = | + | * [[TransportSeed-EDTA]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[ExchangeSeed-EDTA]] | |
− | + | * [[TransportSeed-EDTA]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=edta}} |
− | + | {{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}} | |
− | + | {{#set: molecular-weight=290.229}} | |
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite EDTA
- common-name:
- edta
- smiles:
- c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
- inchi-key:
- kcxvzyzypllwcc-uhfffaoysa-l
- molecular-weight:
- 290.229