Difference between revisions of "CPD-332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == * common-name: ** n-acetyl-α-d-glucosamine 1-phosphate * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD1G-1344 == * common-name: ** α, α'-trehalose 6-α-mycolate * smiles: ** ccccccccccccccccccccccccccc(c(o)ccccccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-D-GLUCOSAMINE-1-P ==
+
== Metabolite CPD1G-1344 ==
 
* common-name:
 
* common-name:
** n-acetyl-α-d-glucosamine 1-phosphate
+
** α, α'-trehalose 6-α-mycolate
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
+
** ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)co)o)o)o))
 
* inchi-key:
 
* inchi-key:
** fzljpepaypummr-fmdgeedcsa-l
+
** haspjlrxbagtid-bgzciimlsa-n
 
* molecular-weight:
 
* molecular-weight:
** 299.174
+
** 1462.341
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAG1P-URIDYLTRANS-RXN]]
 
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.157-RXN]]
+
* [[RXN1G-1435]]
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 
* [[RXN-16426]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}}
+
{{#set: common-name=α, α'-trehalose 6-α-mycolate}}
{{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}}
+
{{#set: inchi-key=inchikey=haspjlrxbagtid-bgzciimlsa-n}}
{{#set: molecular-weight=299.174}}
+
{{#set: molecular-weight=1462.341}}

Revision as of 11:16, 15 January 2021

Metabolite CPD1G-1344

  • common-name:
    • α, α'-trehalose 6-α-mycolate
  • smiles:
    • ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)co)o)o)o))
  • inchi-key:
    • haspjlrxbagtid-bgzciimlsa-n
  • molecular-weight:
    • 1462.341

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality