Difference between revisions of "CPD-332"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19917 == * transcription-direction: ** positive * right-end-position: ** 444887 * left-end-position: ** 428304 * centisome-position: ** 68.63153...") |
(Created page with "Category:metabolite == Metabolite CPD-332 == * common-name: ** dihydrozeatin * smiles: ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) * inchi-key: ** xxfactaygkkoqb-zetcqymhsa-n * mo...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-332 == |
| − | * | + | * common-name: |
| − | ** | + | ** dihydrozeatin |
| − | * | + | * smiles: |
| − | ** | + | ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** xxfactaygkkoqb-zetcqymhsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 221.261 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-4726]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=dihydrozeatin}} | |
| − | + | {{#set: inchi-key=inchikey=xxfactaygkkoqb-zetcqymhsa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=221.261}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-332
- common-name:
- dihydrozeatin
- smiles:
- cc(co)ccnc2(=nc=nc1(=c(n=cn1)2))
- inchi-key:
- xxfactaygkkoqb-zetcqymhsa-n
- molecular-weight:
- 221.261
