Difference between revisions of "CPD-332"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYINOSINE == * common-name: ** 2'-deoxyinosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) * inchi-key: ** vgontnsxdcqugy-...") |
(Created page with "Category:metabolite == Metabolite CPD-332 == * common-name: ** dihydrozeatin * smiles: ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) * inchi-key: ** xxfactaygkkoqb-zetcqymhsa-n * mo...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-332 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrozeatin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xxfactaygkkoqb-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 221.261 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4726]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrozeatin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xxfactaygkkoqb-zetcqymhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=221.261}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-332
- common-name:
- dihydrozeatin
- smiles:
- cc(co)ccnc2(=nc=nc1(=c(n=cn1)2))
- inchi-key:
- xxfactaygkkoqb-zetcqymhsa-n
- molecular-weight:
- 221.261
