Difference between revisions of "CPD-332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CHOLANATE2 == * common-name: ** 3α,12α-dihydroxy-7-oxo-5β-cholan-24-oate * smiles: ** cc([ch]3(cc[ch]4([ch]2(c(=o)c[ch]1...")
(Created page with "Category:metabolite == Metabolite OH-HEXANOYL-COA == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CHOLANATE2 ==
+
== Metabolite OH-HEXANOYL-COA ==
 
* common-name:
 
* common-name:
** 3α,12α-dihydroxy-7-oxo-5β-cholan-24-oate
+
** (s)-3-hydroxyhexanoyl-coa
 
* smiles:
 
* smiles:
** cc([ch]3(cc[ch]4([ch]2(c(=o)c[ch]1(cc(o)ccc(c)1[ch]2cc(o)c(c)34)))))ccc(=o)[o-]
+
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** rhcpkknrwfxmat-rrwykfpjsa-m
+
** vaahkrmgofiorx-dwufxmdisa-j
 
* molecular-weight:
 
* molecular-weight:
** 405.553
+
** 877.646
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12567]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[7-ALPHA-HYDROXYSTEROID-DEH-RXN]]
+
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3α,12α-dihydroxy-7-oxo-5β-cholan-24-oate}}
+
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
{{#set: inchi-key=inchikey=rhcpkknrwfxmat-rrwykfpjsa-m}}
+
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
{{#set: molecular-weight=405.553}}
+
{{#set: molecular-weight=877.646}}

Revision as of 14:57, 5 January 2021

Metabolite OH-HEXANOYL-COA

  • common-name:
    • (s)-3-hydroxyhexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • vaahkrmgofiorx-dwufxmdisa-j
  • molecular-weight:
    • 877.646

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality