Difference between revisions of "CPD-332"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYINOSINE == * common-name: ** 2'-deoxyinosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) * inchi-key: ** vgontnsxdcqugy-...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == * common-name: ** n-acetyl-α-d-glucosamine 1-phosphate * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-α-d-glucosamine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fzljpepaypummr-fmdgeedcsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 299.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NAG1P-URIDYLTRANS-RXN]] |
| + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.1.157-RXN]] |
| − | * [[ | + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] |
| + | * [[RXN-16426]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=299.174}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- common-name:
- n-acetyl-α-d-glucosamine 1-phosphate
- smiles:
- cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
- inchi-key:
- fzljpepaypummr-fmdgeedcsa-l
- molecular-weight:
- 299.174
