Difference between revisions of "CPD-335"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13533 == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite CPD-335 == * common-name: ** (r)-3-hydroxybutanoate * smiles: ** cc(cc([o-])=o)o * inchi-key: ** whbmmwsbfzvssr-gsvougtgsa-m * molecular-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13533 ==
+
== Metabolite CPD-335 ==
 
* common-name:
 
* common-name:
** (3r)-3-hydroxypentanoyl-coa
+
** (r)-3-hydroxybutanoate
 
* smiles:
 
* smiles:
** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+
** cc(cc([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** yygypcrwzmlsgk-orumcernsa-j
+
** whbmmwsbfzvssr-gsvougtgsa-m
 
* molecular-weight:
 
* molecular-weight:
** 863.619
+
** 103.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12560]]
+
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
 +
* [[HBNOm]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
 +
* [[3.1.1.75-RXN]]
 +
* [[HBNOm]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-3-hydroxypentanoyl-coa}}
+
{{#set: common-name=(r)-3-hydroxybutanoate}}
{{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}}
+
{{#set: inchi-key=inchikey=whbmmwsbfzvssr-gsvougtgsa-m}}
{{#set: molecular-weight=863.619}}
+
{{#set: molecular-weight=103.097}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-335

  • common-name:
    • (r)-3-hydroxybutanoate
  • smiles:
    • cc(cc([o-])=o)o
  • inchi-key:
    • whbmmwsbfzvssr-gsvougtgsa-m
  • molecular-weight:
    • 103.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality