Difference between revisions of "CPD-335"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...") |
(Created page with "Category:metabolite == Metabolite CPD-335 == * common-name: ** (r)-3-hydroxybutanoate * smiles: ** cc(cc([o-])=o)o * inchi-key: ** whbmmwsbfzvssr-gsvougtgsa-m * molecular-...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-335 == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** (r)-3-hydroxybutanoate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(cc([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** whbmmwsbfzvssr-gsvougtgsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 103.097 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[3- | + | * [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
− | * [[ | + | * [[HBNOm]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[3- | + | * [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
− | * [[RXN | + | * [[3.1.1.75-RXN]] |
+ | * [[HBNOm]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=(r)-3-hydroxybutanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=whbmmwsbfzvssr-gsvougtgsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.097}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-335
- common-name:
- (r)-3-hydroxybutanoate
- smiles:
- cc(cc([o-])=o)o
- inchi-key:
- whbmmwsbfzvssr-gsvougtgsa-m
- molecular-weight:
- 103.097