Difference between revisions of "CPD-341"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN == * common-name: ** phlorisovalerophenone * smiles: ** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-341 == * common-name: ** indole-3-ethanol * smiles: ** c2(=c(cco)c1(c=cc=cc=1n2)) * inchi-key: ** mbbomcvgycrmea-uhfffaoysa-n * molec...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-341 == |
* common-name: | * common-name: | ||
| − | ** | + | ** indole-3-ethanol |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(=c(cco)c1(c=cc=cc=1n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mbbomcvgycrmea-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 161.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10717]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indole-3-ethanol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mbbomcvgycrmea-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=161.203}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-341
- common-name:
- indole-3-ethanol
- smiles:
- c2(=c(cco)c1(c=cc=cc=1n2))
- inchi-key:
- mbbomcvgycrmea-uhfffaoysa-n
- molecular-weight:
- 161.203
