Difference between revisions of "CPD-3481"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.26-RXN 3.5.1.26-RXN] == * direction: ** left-to-right * common-name: ** l-asparaginase * ec-n...")
(Created page with "Category:metabolite == Metabolite CPD-3481 == * common-name: ** bupropion * smiles: ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** snppwiuozrmyny-uhfffaoysa-o *...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.26-RXN 3.5.1.26-RXN] ==
+
== Metabolite CPD-3481 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-asparaginase
+
** bupropion
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.1.26 ec-3.5.1.26]
+
** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ACETYL-ETCETERA-L-ASPARAGINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-ASPARTATE]][c] '''+''' 1 [[N-ACETYL-BETA-GLUCOSAMINYLAMINE]][c] '''+''' 1 [[PROTON]][c]
+
** snppwiuozrmyny-uhfffaoysa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ08230]]
+
** 240.752
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN66-181]]
−
* Gene: [[SJ17531]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=bupropion}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=snppwiuozrmyny-uhfffaoysa-o}}
−
* [[ASPARAGINE-DEG1-PWY-1]], L-asparagine degradation III (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINE-DEG1-PWY-1 ASPARAGINE-DEG1-PWY-1]
+
{{#set: molecular-weight=240.752}}
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11545 11545]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03421 R03421]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P20933 P20933]
 
−
** [http://www.uniprot.org/uniprot/Q47898 Q47898]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=l-asparaginase}}
 
−
{{#set: ec-number=ec-3.5.1.26}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-3481

  • common-name:
    • bupropion
  • smiles:
    • cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1)
  • inchi-key:
    • snppwiuozrmyny-uhfffaoysa-o
  • molecular-weight:
    • 240.752

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-3481&oldid=138867"