Difference between revisions of "CPD-3483"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09197 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-3483 == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** akoaevosdhivfx-uhfffa...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3483 == |
| − | + | * common-name: | |
| − | * [ | + | ** hydroxybupropion |
| − | == | + | * smiles: |
| − | * | + | ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) |
| − | + | * inchi-key: | |
| − | ** | + | ** akoaevosdhivfx-uhfffaoysa-o |
| − | * | + | * molecular-weight: |
| − | + | ** 256.752 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN66-181]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=hydroxybupropion}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=akoaevosdhivfx-uhfffaoysa-o}} |
| − | {{#set: | + | {{#set: molecular-weight=256.752}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-3483
- common-name:
- hydroxybupropion
- smiles:
- cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1)
- inchi-key:
- akoaevosdhivfx-uhfffaoysa-o
- molecular-weight:
- 256.752
