Difference between revisions of "CPD-3486"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14933 == * transcription-direction: ** negative * right-end-position: ** 8416 * left-end-position: ** 4923 * centisome-position: ** 56.99236 ==...")
(Created page with "Category:metabolite == Metabolite CPD-3486 == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) * inchi-key: ** lulayugmbfyyex-uhfffaoysa-m * mo...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14933 ==
+
== Metabolite CPD-3486 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-chlorobenzoate
−
* right-end-position:
+
* smiles:
−
** 8416
+
** c1(c=c(cl)c=c(c=1)c(=o)[o-])
−
* left-end-position:
+
* inchi-key:
−
** 4923
+
** lulayugmbfyyex-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 56.99236   
+
** 155.56
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-9910]]
−
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=3-chlorobenzoate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=lulayugmbfyyex-uhfffaoysa-m}}
−
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+
{{#set: molecular-weight=155.56}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PURINE-NUCLEOSIDASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-363]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-366]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-6153]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6154]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6151]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-I9]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6754]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY0-1391]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6596]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6607]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6606]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6599]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=8416}}
 
−
{{#set: left-end-position=4923}}
 
−
{{#set: centisome-position=56.99236    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=10}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite CPD-3486

  • common-name:
    • 3-chlorobenzoate
  • smiles:
    • c1(c=c(cl)c=c(c=1)c(=o)[o-])
  • inchi-key:
    • lulayugmbfyyex-uhfffaoysa-m
  • molecular-weight:
    • 155.56

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-3486&oldid=136586"