Difference between revisions of "CPD-3486"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21111 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * UDPNACETYLMURAMATEDEHYDR...") |
(Created page with "Category:metabolite == Metabolite CPD-3486 == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) * inchi-key: ** lulayugmbfyyex-uhfffaoysa-m * mo...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3486 == |
| − | + | * common-name: | |
| − | * | + | ** 3-chlorobenzoate |
| − | + | * smiles: | |
| − | * | + | ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** lulayugmbfyyex-uhfffaoysa-m |
| − | == | + | * molecular-weight: |
| − | + | ** 155.56 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[RXN-9910]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | ** | + | {{#set: common-name=3-chlorobenzoate}} |
| − | * [[ | + | {{#set: inchi-key=inchikey=lulayugmbfyyex-uhfffaoysa-m}} |
| − | + | {{#set: molecular-weight=155.56}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD-3486
- common-name:
- 3-chlorobenzoate
- smiles:
- c1(c=c(cl)c=c(c=1)c(=o)[o-])
- inchi-key:
- lulayugmbfyyex-uhfffaoysa-m
- molecular-weight:
- 155.56
