Difference between revisions of "CPD-352"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c...")
(Created page with "Category:metabolite == Metabolite CPD-352 == * common-name: ** 17β-estradiol * smiles: ** cc12([ch](ccc(o)1)[ch]4([ch](cc2)c3(c(=cc(o)=cc=3)cc4))) * inchi-key: ** vox...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18666 ==
+
== Metabolite CPD-352 ==
 
* common-name:
 
* common-name:
** epoxypheophorbide a
+
** 17β-estradiol
 
* smiles:
 
* smiles:
** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
+
** cc12([ch](ccc(o)1)[ch]4([ch](cc2)c3(c(=cc(o)=cc=3)cc4)))
 
* inchi-key:
 
* inchi-key:
** zmtpzdvbgynplz-ygowezgdsa-m
+
** voxzdwnpvjitmn-zbrfxrbcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 606.677
+
** 272.386
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17252]]
+
* [[ESTRADIOL-17-BETA-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=epoxypheophorbide a}}
+
{{#set: common-name=17β-estradiol}}
{{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}}
+
{{#set: inchi-key=inchikey=voxzdwnpvjitmn-zbrfxrbcsa-n}}
{{#set: molecular-weight=606.677}}
+
{{#set: molecular-weight=272.386}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-352

  • common-name:
    • 17β-estradiol
  • smiles:
    • cc12([ch](ccc(o)1)[ch]4([ch](cc2)c3(c(=cc(o)=cc=3)cc4)))
  • inchi-key:
    • voxzdwnpvjitmn-zbrfxrbcsa-n
  • molecular-weight:
    • 272.386

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality