Difference between revisions of "CPD-356"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite Monoamines == * common-name: ** a monoamine == Reaction(s) known to consume the compound == * RXN-9598 == Reaction(s) known to produc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
+
== Metabolite Monoamines ==
 
* common-name:
 
* common-name:
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
+
** a monoamine
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
 
* inchi-key:
 
** whmxlrrvaneoog-mvfiekmpsa-l
 
* molecular-weight:
 
** 715.004
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9598]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.42-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=a monoamine}}
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
 
{{#set: molecular-weight=715.004}}
 

Revision as of 08:26, 15 March 2021

Metabolite Monoamines

  • common-name:
    • a monoamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality