Difference between revisions of "CPD-356"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite CPD-356 == * common-name: ** d-arabinono-1,4-lactone * smiles: ** c(o)c1(oc(=o)c(o)c(o)1) * inchi-key: ** cuokhacjlgprhd-jjyyjpossa-n * m...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
+
== Metabolite CPD-356 ==
 
* common-name:
 
* common-name:
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
+
** d-arabinono-1,4-lactone
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
+
** c(o)c1(oc(=o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** whmxlrrvaneoog-mvfiekmpsa-l
+
** cuokhacjlgprhd-jjyyjpossa-n
 
* molecular-weight:
 
* molecular-weight:
** 715.004
+
** 148.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.3.37-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.42-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=d-arabinono-1,4-lactone}}
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
+
{{#set: inchi-key=inchikey=cuokhacjlgprhd-jjyyjpossa-n}}
{{#set: molecular-weight=715.004}}
+
{{#set: molecular-weight=148.115}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-356

  • common-name:
    • d-arabinono-1,4-lactone
  • smiles:
    • c(o)c1(oc(=o)c(o)c(o)1)
  • inchi-key:
    • cuokhacjlgprhd-jjyyjpossa-n
  • molecular-weight:
    • 148.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality