Difference between revisions of "CPD-3569"

Revision as of 08:30, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12902 ==
+== Metabolite GLYOX ==
 * common-name:
-** 5-methylhex-4-enoyl-coa
+** glyoxylate
 * smiles:
-** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** [ch](c(=o)[o-])=o
 * inchi-key:
-** beyylhumfmwplh-svhodsnwsa-j
+** hhlfwlyxyjoton-uhfffaoysa-m
 * molecular-weight:
-** 873.658
+** 73.028
 == Reaction(s) known to consume the compound ==
+* [[4OH2OXOGLUTARALDOL-RXN]]
+* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
+* [[GLYCINE-AMINOTRANSFERASE-RXN]]
+* [[GLYOXYLATE-OXIDASE-RXN]]
+* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
+* [[ISOCIT-CLEAV-RXN]]
+* [[MALSYN-RXN]]
+* [[RXN-13990]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11917]]
+* [[1.4.3.19-RXN]]
+* [[4OH2OXOGLUTARALDOL-RXN]]
+* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
+* [[GLYCINE-AMINOTRANSFERASE-RXN]]
+* [[GLYCOLATEDEHYDRO-RXN]]
+* [[HDAO10x]]
+* [[ISOCIT-CLEAV-RXN]]
+* [[RXN-13990]]
+* [[RXN-17951]]
+* [[RXN-8673]]
+* [[RXN-8674]]
+* [[RXN-969]]
+* [[RXN0-7229]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-methylhex-4-enoyl-coa}}
+{{#set: common-name=glyoxylate}}
-{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
+{{#set: inchi-key=inchikey=hhlfwlyxyjoton-uhfffaoysa-m}}
-{{#set: molecular-weight=873.658}}
+{{#set: molecular-weight=73.028}}