Difference between revisions of "CPD-3569"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLYOX == * common-name: ** glyoxylate * smiles: ** [ch](c(=o)[o-])=o * inchi-key: ** hhlfwlyxyjoton-uhfffaoysa-m * molecular-weight: ** 7...")
(Created page with "Category:metabolite == Metabolite CPD-3569 == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o * inchi-key: ** iefjwdngdzaynz-bypyzuc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLYOX ==
+
== Metabolite CPD-3569 ==
 
* common-name:
 
* common-name:
** glyoxylate
+
** glycyl-l-glutamate
 
* smiles:
 
* smiles:
** [ch](c(=o)[o-])=o
+
** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** hhlfwlyxyjoton-uhfffaoysa-m
+
** iefjwdngdzaynz-bypyzucnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 73.028
+
** 203.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OH2OXOGLUTARALDOL-RXN]]
+
* [[RXN0-6984]]
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
* [[GLYOXYLATE-OXIDASE-RXN]]
 
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 
* [[ISOCIT-CLEAV-RXN]]
 
* [[MALSYN-RXN]]
 
* [[RXN-13990]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.4.3.19-RXN]]
 
* [[4OH2OXOGLUTARALDOL-RXN]]
 
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
* [[GLYCOLATEDEHYDRO-RXN]]
 
* [[HDAO10x]]
 
* [[ISOCIT-CLEAV-RXN]]
 
* [[RXN-13990]]
 
* [[RXN-17951]]
 
* [[RXN-8673]]
 
* [[RXN-8674]]
 
* [[RXN-969]]
 
* [[RXN0-7229]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glyoxylate}}
+
{{#set: common-name=glycyl-l-glutamate}}
{{#set: inchi-key=inchikey=hhlfwlyxyjoton-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}}
{{#set: molecular-weight=73.028}}
+
{{#set: molecular-weight=203.174}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-3569

  • common-name:
    • glycyl-l-glutamate
  • smiles:
    • c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
  • inchi-key:
    • iefjwdngdzaynz-bypyzucnsa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality