|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13603 RXN-13603] == | + | == Metabolite CPD-3569 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** neolinustatin β-diglucosidase | + | ** glycyl-l-glutamate |
| − | ** beta-glucosidase
| + | * smiles: |
| − | ** neolinustatinase (β-diglucosidase) | + | ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o |
| − | * ec-number:
| + | * inchi-key: |
| − | ** [http://enzyme.expasy.org/EC/3.2.1.21 ec-3.2.1.21] | + | ** iefjwdngdzaynz-bypyzucnsa-m |
| − | == Reaction formula ==
| + | * molecular-weight: |
| − | * 1 [[CPD-14596]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-10277]][c] '''+''' 1 [[Glucopyranose]][c]
| + | ** 203.174 |
| − | == Gene(s) associated with this reaction == | + | == Reaction(s) known to consume the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RXN0-6984]] |
| − | * Gene: [[SJ14193]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=glycyl-l-glutamate}} |
| − | * Gene: [[SJ05533]]
| + | {{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=203.174}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ19930]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ18897]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ11958]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ04559]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ14973]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ05740]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ05257]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ18318]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ16402]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ04558]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ05782]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ05741]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ05532]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ17199]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ00855]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7092]], neolinustatin bioactivation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7092 PWY-7092] | |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=beta-glucosidase|neolinustatinase (β-diglucosidase)|neolinustatin β-diglucosidase}} | |
| − | {{#set: ec-number=ec-3.2.1.21}} | |
| − | {{#set: nb gene associated=17}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
