Difference between revisions of "CPD-3569"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CTP == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-3569 == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o * inchi-key: ** iefjwdngdzaynz-bypyzuc...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3569 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-glutamate |
* smiles: | * smiles: | ||
| − | ** c | + | ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iefjwdngdzaynz-bypyzucnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN0-6984]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN0- | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-glutamate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.174}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-3569
- common-name:
- glycyl-l-glutamate
- smiles:
- c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
- inchi-key:
- iefjwdngdzaynz-bypyzucnsa-m
- molecular-weight:
- 203.174
