Difference between revisions of "CPD-3569"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATEDEHYDROG-RXN PREPHENATEDEHYDROG-RXN] == * direction: ** left-to-right * common-name: ** p...")
(Created page with "Category:metabolite == Metabolite CTP == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2)) * inchi-key: **...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATEDEHYDROG-RXN PREPHENATEDEHYDROG-RXN] ==
+
== Metabolite CTP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** prephenate dehydrogenase
+
** ctp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.12 ec-1.3.1.12]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NAD]][c] '''+''' 1 [[PREPHENATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[P-HYDROXY-PHENYLPYRUVATE]][c]
+
** pcdqprrszkqhhs-xvfcmesisa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00045]]
+
** 479.127
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[2.7.7.14-RXN]]
−
== Pathway(s) ==
+
* [[2.7.7.15-RXN]]
−
* [[PWY-7303]], 3-dimethylallyl-4-hydroxybenzoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7303 PWY-7303]
+
* [[2.7.7.60-RXN]]
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
* [[CDPDIGLYSYN-RXN]]
−
* [[TYRSYN]], L-tyrosine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=TYRSYN TYRSYN]
+
* [[CHLPCTDh]]
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[DOLICHOL-KINASE-RXN]]
−
== Reconstruction information  ==
+
* [[P-PANTOCYSLIG-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-12195]]
−
== External links  ==
+
* [[RXN-12200]]
−
* RHEA:
+
* [[RXN-12959]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13870 13870]
+
* [[RXN-15091]]
−
* LIGAND-RXN:
+
* [[RXN-7683]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01728 R01728]
+
* [[RXN0-383]]
−
* UNIPROT:
+
* [[RXN0-5515]]
−
** [http://www.uniprot.org/uniprot/Q9CET9 Q9CET9]
+
* [[RXN0-723]]
−
** [http://www.uniprot.org/uniprot/Q9PIZ7 Q9PIZ7]
+
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
−
** [http://www.uniprot.org/uniprot/P43902 P43902]
+
== Reaction(s) known to produce the compound ==
−
** [http://www.uniprot.org/uniprot/P07023 P07023]
+
* [[ATCD]]
−
** [http://www.uniprot.org/uniprot/Q04983 Q04983]
+
* [[ATCDm]]
−
** [http://www.uniprot.org/uniprot/Q02287 Q02287]
+
* [[CDPKIN-RXN]]
−
** [http://www.uniprot.org/uniprot/P43901 P43901]
+
* [[CTPSYN-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-14325]]
−
{{#set: common-name=prephenate dehydrogenase}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: ec-number=ec-1.3.1.12}}
+
{{#set: common-name=ctp}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=pcdqprrszkqhhs-xvfcmesisa-j}}
−
{{#set: nb pathway associated=2}}
+
{{#set: molecular-weight=479.127}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CTP

  • common-name:
    • ctp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
  • inchi-key:
    • pcdqprrszkqhhs-xvfcmesisa-j
  • molecular-weight:
    • 479.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-3569&oldid=48205"