Difference between revisions of "CPD-3569"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATEDEHYDROG-RXN PREPHENATEDEHYDROG-RXN] == * direction: ** left-to-right * common-name: ** p...")
(Created page with "Category:metabolite == Metabolite CPD-3569 == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o * inchi-key: ** iefjwdngdzaynz-bypyzuc...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATEDEHYDROG-RXN PREPHENATEDEHYDROG-RXN] ==
+
== Metabolite CPD-3569 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** prephenate dehydrogenase
+
** glycyl-l-glutamate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.1.12 ec-1.3.1.12]
+
** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
== Reaction formula ==
+
* inchi-key:
* 1 [[NAD]][c] '''+''' 1 [[PREPHENATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[P-HYDROXY-PHENYLPYRUVATE]][c]
+
** iefjwdngdzaynz-bypyzucnsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ00045]]
+
** 203.174
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN0-6984]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-7303]], 3-dimethylallyl-4-hydroxybenzoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7303 PWY-7303]
+
== Reaction(s) of unknown directionality ==
** '''1''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=glycyl-l-glutamate}}
* [[TYRSYN]], L-tyrosine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=TYRSYN TYRSYN]
+
{{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}}
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=203.174}}
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13870 13870]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01728 R01728]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q9CET9 Q9CET9]
 
** [http://www.uniprot.org/uniprot/Q9PIZ7 Q9PIZ7]
 
** [http://www.uniprot.org/uniprot/P43902 P43902]
 
** [http://www.uniprot.org/uniprot/P07023 P07023]
 
** [http://www.uniprot.org/uniprot/Q04983 Q04983]
 
** [http://www.uniprot.org/uniprot/Q02287 Q02287]
 
** [http://www.uniprot.org/uniprot/P43901 P43901]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=prephenate dehydrogenase}}
 
{{#set: ec-number=ec-1.3.1.12}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-3569

  • common-name:
    • glycyl-l-glutamate
  • smiles:
    • c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
  • inchi-key:
    • iefjwdngdzaynz-bypyzucnsa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality