Difference between revisions of "CPD-358"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
(Created page with "Category:metabolite == Metabolite CPD-358 == * common-name: ** (r)-lactaldehyde * smiles: ** cc([ch]=o)o * inchi-key: ** bsabbbmnwqwllu-gsvougtgsa-n * molecular-weight: **...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
+
== Metabolite CPD-358 ==
 
* common-name:
 
* common-name:
** 2,4-dinitrophenyl-s-glutathione
+
** (r)-lactaldehyde
 
* smiles:
 
* smiles:
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
+
** cc([ch]=o)o
 
* inchi-key:
 
* inchi-key:
** fxeukvkgtkddiq-uwvggrqhsa-m
+
** bsabbbmnwqwllu-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 472.406
+
** 74.079
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GST-RXN]]
+
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GST-RXN]]
+
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
+
{{#set: common-name=(r)-lactaldehyde}}
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
+
{{#set: inchi-key=inchikey=bsabbbmnwqwllu-gsvougtgsa-n}}
{{#set: molecular-weight=472.406}}
+
{{#set: molecular-weight=74.079}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-358

  • common-name:
    • (r)-lactaldehyde
  • smiles:
    • cc([ch]=o)o
  • inchi-key:
    • bsabbbmnwqwllu-gsvougtgsa-n
  • molecular-weight:
    • 74.079

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality