Difference between revisions of "CPD-36"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIACYLGLYCEROL-PYROPHOSPHATE == * common-name: ** a 1,2-diacyl-sn-glycerol 3-diphosphate == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-36 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-36 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine |
| + | * smiles: | ||
| + | ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) | ||
| + | * inchi-key: | ||
| + | ** dlgjwsvwtwewbj-ztvljyeesa-m | ||
| + | * molecular-weight: | ||
| + | ** 378.312 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12178]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}} |
| + | {{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}} | ||
| + | {{#set: molecular-weight=378.312}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-36
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- dlgjwsvwtwewbj-ztvljyeesa-m
- molecular-weight:
- 378.312
