|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THI-P-SYN-RXN THI-P-SYN-RXN] == | + | == Metabolite CPD-36 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** thiamine phosphate synthase | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.5.1.3 ec-2.5.1.3]
| + | ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[THZ-P]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[THIAMINE-P]][c]
| + | ** dlgjwsvwtwewbj-ztvljyeesa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ18183]]
| + | ** 378.312 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-12178]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}} |
| − | * Gene: [[SJ20500]]
| + | {{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=378.312}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY-6908]], thiamine diphosphate biosynthesis IV (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] | |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[PWY-7357]], thiamine formation from pyrithiamine and oxythiamine (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7357 PWY-7357]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6897]], thiamine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22329 22329]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03223 R03223]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P41835 P41835]
| |
| − | ** [http://www.uniprot.org/uniprot/P71350 P71350]
| |
| − | ** [http://www.uniprot.org/uniprot/O25514 O25514]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PNL3 Q9PNL3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JWI2 Q9JWI2]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZL01 Q9ZL01]
| |
| − | ** [http://www.uniprot.org/uniprot/P30137 P30137]
| |
| − | ** [http://www.uniprot.org/uniprot/P39594 P39594]
| |
| − | ** [http://www.uniprot.org/uniprot/P40386 P40386]
| |
| − | ** [http://www.uniprot.org/uniprot/P72965 P72965]
| |
| − | ** [http://www.uniprot.org/uniprot/O48881 O48881]
| |
| − | ** [http://www.uniprot.org/uniprot/O34294 O34294]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZBL5 Q9ZBL5]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=thiamine phosphate synthase}} | |
| − | {{#set: ec-number=ec-2.5.1.3}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
| |
