Difference between revisions of "CPD-3617"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TAGATOSE-6-PHOSPHATE == * common-name: ** d-tagatofuranose 6-phosphate * smiles: ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GALACTOSYLCERAMIDE-SULFATE == |
* common-name: | * common-name: | ||
− | ** | + | ** a sulfatide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a sulfatide}} |
− | |||
− |
Revision as of 11:18, 15 January 2021
Contents
Metabolite GALACTOSYLCERAMIDE-SULFATE
- common-name:
- a sulfatide