Difference between revisions of "CPD-3617"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CPD-3617 == * common-name: ** decanoate * smiles: ** cccccccccc(=o)[o-] * inchi-key: ** ghvnfzfcnzkvnt-uhfffaoysa-m * molecular-weight: *...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-3617 == |
* common-name: | * common-name: | ||
− | ** | + | ** decanoate |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ghvnfzfcnzkvnt-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 171.259 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13614]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16653]] |
+ | * [[RXN-9628]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=decanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghvnfzfcnzkvnt-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=171.259}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-3617
- common-name:
- decanoate
- smiles:
- cccccccccc(=o)[o-]
- inchi-key:
- ghvnfzfcnzkvnt-uhfffaoysa-m
- molecular-weight:
- 171.259