Difference between revisions of "CPD-3618"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvs...") |
(Created page with "Category:metabolite == Metabolite CPD-3618 == * common-name: ** 2-oxovalerate * smiles: ** cccc(=o)c(=o)[o-] * inchi-key: ** kdvfrmmrzocfls-uhfffaoysa-m * molecular-weight...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3618 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-oxovalerate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccc(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kdvfrmmrzocfls-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 115.108 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14986]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-oxovalerate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kdvfrmmrzocfls-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=115.108}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-3618
- common-name:
- 2-oxovalerate
- smiles:
- cccc(=o)c(=o)[o-]
- inchi-key:
- kdvfrmmrzocfls-uhfffaoysa-m
- molecular-weight:
- 115.108
