Difference between revisions of "CPD-365"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-SEDOHEPTULOSE-7-P == * common-name: ** d-sedoheptulose 7-phosphate == Reaction(s) known to consume the compound == * 1TRANSKETO-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-365 == |
* common-name: | * common-name: | ||
| − | ** d- | + | ** 1-keto-d-chiro-inositol |
| + | * smiles: | ||
| + | ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** vyegbdhsghxogt-qfycrykcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 178.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14148]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14148]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=1-keto-d-chiro-inositol}} |
| + | {{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}} | ||
| + | {{#set: molecular-weight=178.141}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-365
- common-name:
- 1-keto-d-chiro-inositol
- smiles:
- c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
- inchi-key:
- vyegbdhsghxogt-qfycrykcsa-n
- molecular-weight:
- 178.141
