Difference between revisions of "CPD-365"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-Oxo-carboxylates == * common-name: ** a 2-oxo carboxylate == Reaction(s) known to consume the compound == * 1.1.1.272-RXN * ALANI...")
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-Oxo-carboxylates ==
+
== Metabolite CPD-365 ==
 
* common-name:
 
* common-name:
** a 2-oxo carboxylate
+
** 1-keto-d-chiro-inositol
 +
* smiles:
 +
** c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
 +
* inchi-key:
 +
** vyegbdhsghxogt-qfycrykcsa-n
 +
* molecular-weight:
 +
** 178.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.272-RXN]]
+
* [[RXN-14148]]
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[RXN-13927]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.272-RXN]]
+
* [[RXN-14148]]
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[L-AMINO-ACID-OXIDASE-RXN]]
 
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[RXN-13927]]
 
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-oxo carboxylate}}
+
{{#set: common-name=1-keto-d-chiro-inositol}}
 +
{{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}}
 +
{{#set: molecular-weight=178.141}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-365

  • common-name:
    • 1-keto-d-chiro-inositol
  • smiles:
    • c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
  • inchi-key:
    • vyegbdhsghxogt-qfycrykcsa-n
  • molecular-weight:
    • 178.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality