Difference between revisions of "CPD-367"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17298 == * common-name: ** (7z,10z,13z)-sn2-monogalactosyldiacylglycerol == Reaction(s) known to consume the compound == == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-367 == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(=o)=o * inchi-key: ** cqqgiwjsicouon-reohclbhsa-l *...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-367 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (2r)-3-sulfolactate |
+ | * smiles: | ||
+ | ** c(=o)([o-])c(o)cs([o-])(=o)=o | ||
+ | * inchi-key: | ||
+ | ** cqqgiwjsicouon-reohclbhsa-l | ||
+ | * molecular-weight: | ||
+ | ** 168.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R230-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[R230-RXN]] |
+ | * [[RXN-11727]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(2r)-3-sulfolactate}} |
+ | {{#set: inchi-key=inchikey=cqqgiwjsicouon-reohclbhsa-l}} | ||
+ | {{#set: molecular-weight=168.121}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-367
- common-name:
- (2r)-3-sulfolactate
- smiles:
- c(=o)([o-])c(o)cs([o-])(=o)=o
- inchi-key:
- cqqgiwjsicouon-reohclbhsa-l
- molecular-weight:
- 168.121