Difference between revisions of "CPD-367"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13640 == * transcription-direction: ** positive * right-end-position: ** 177370 * left-end-position: ** 171798 * centisome-position: ** 51.744514...") |
(Created page with "Category:metabolite == Metabolite CPD-367 == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(=o)=o * inchi-key: ** cqqgiwjsicouon-reohclbhsa-l *...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-367 == |
| − | * | + | * common-name: |
| − | ** | + | ** (2r)-3-sulfolactate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)([o-])c(o)cs([o-])(=o)=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** cqqgiwjsicouon-reohclbhsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 168.121 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[R230-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN | + | * [[R230-RXN]] |
| − | * | + | * [[RXN-11727]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=(2r)-3-sulfolactate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=cqqgiwjsicouon-reohclbhsa-l}} |
| − | + | {{#set: molecular-weight=168.121}} | |
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-367
- common-name:
- (2r)-3-sulfolactate
- smiles:
- c(=o)([o-])c(o)cs([o-])(=o)=o
- inchi-key:
- cqqgiwjsicouon-reohclbhsa-l
- molecular-weight:
- 168.121
