Difference between revisions of "CPD-367"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
(Created page with "Category:metabolite == Metabolite CPD-367 == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(=o)=o * inchi-key: ** cqqgiwjsicouon-reohclbhsa-l *...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-367 == |
* common-name: | * common-name: | ||
| − | ** 3 | + | ** (2r)-3-sulfolactate |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c(=o)([o-])c(o)cs([o-])(=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqqgiwjsicouon-reohclbhsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 168.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R230-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[R230-RXN]] | ||
| + | * [[RXN-11727]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3 | + | {{#set: common-name=(2r)-3-sulfolactate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqqgiwjsicouon-reohclbhsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=168.121}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-367
- common-name:
- (2r)-3-sulfolactate
- smiles:
- c(=o)([o-])c(o)cs([o-])(=o)=o
- inchi-key:
- cqqgiwjsicouon-reohclbhsa-l
- molecular-weight:
- 168.121
