Difference between revisions of "CPD-367"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16817 == * common-name: ** indoxyl sulfate * smiles: ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) * inchi-key: ** bxffhsidqofmle-uhfffa...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRONEOPTERIN-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydroneopterin 3'-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** plsqmgzyogsoce-xinawcovsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 333.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydroneopterin 3'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=333.197}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite DIHYDRONEOPTERIN-P
- common-name:
- 7,8-dihydroneopterin 3'-phosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
- inchi-key:
- plsqmgzyogsoce-xinawcovsa-l
- molecular-weight:
- 333.197
