Difference between revisions of "CPD-369"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...")
(Created page with "Category:metabolite == Metabolite CPD-369 == * common-name: ** l-iditol * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-untfvmjosa-n * molecular-weight:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15424 ==
+
== Metabolite CPD-369 ==
 
* common-name:
 
* common-name:
** o-carbamoyladenylate
+
** l-iditol
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
+
** c(c(c(c(c(o)co)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** chsnpofvfypelh-kqynxxcusa-m
+
** fbpfztcfmrresa-untfvmjosa-n
 
* molecular-weight:
 
* molecular-weight:
** 389.241
+
** 182.173
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13167]]
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
* [[RXN-13168]]
 
* [[RXN-14553]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14552]]
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-carbamoyladenylate}}
+
{{#set: common-name=l-iditol}}
{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=fbpfztcfmrresa-untfvmjosa-n}}
{{#set: molecular-weight=389.241}}
+
{{#set: molecular-weight=182.173}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-369

  • common-name:
    • l-iditol
  • smiles:
    • c(c(c(c(c(o)co)o)o)o)o
  • inchi-key:
    • fbpfztcfmrresa-untfvmjosa-n
  • molecular-weight:
    • 182.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality