Difference between revisions of "CPD-3705"

Revision as of 18:54, 14 January 2021

common-name:
- resolution of recombinational junction formation of two intact strands

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL ==
+== Metabolite Resolution-of-Recombinational-Junction ==
 * common-name:
-** n-methyl-(r,s)-tetrahydrobenzylisoquinoline
+** resolution of recombinational junction formation of two intact strands
-* smiles:
-** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
-* inchi-key:
-** vkrkvllltihdef-uhfffaoysa-o
-* molecular-weight:
-** 238.352
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[2.1.1.115-RXN]]
+* [[3.1.22.4-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}}
+{{#set: common-name=resolution of recombinational junction formation of two intact strands}}
-{{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}}
-{{#set: molecular-weight=238.352}}