Difference between revisions of "CPD-3707"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)o...")
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1028 ==
+
== Metabolite CPD-3707 ==
 
* common-name:
 
* common-name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** adenosine 2',3'-cyclic monophosphate
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
+
** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
 
* inchi-key:
 
* inchi-key:
** oinneunvozhbox-kwbdajkesa-k
+
** kmywvddipvnlme-kqynxxcusa-m
 
* molecular-weight:
 
* molecular-weight:
** 447.424
+
** 328.201
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12057]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5180]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: common-name=adenosine 2',3'-cyclic monophosphate}}
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
+
{{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}}
{{#set: molecular-weight=447.424}}
+
{{#set: molecular-weight=328.201}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-3707

  • common-name:
    • adenosine 2',3'-cyclic monophosphate
  • smiles:
    • c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
  • inchi-key:
    • kmywvddipvnlme-kqynxxcusa-m
  • molecular-weight:
    • 328.201

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality