Difference between revisions of "CPD-3707"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 18S-rRNA-N1-methylpseudouridine-1191 == * common-name: ** an 18s rrna n1-methylpseudouridine1191 == Reaction(s) known to consume the comp...") |
(Created page with "Category:metabolite == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == * common-name: ** 2-(α-hydroxyethyl)thiamine diphosphate * smiles: ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-(α-hydroxyethyl)thiamine diphosphate |
| + | * smiles: | ||
| + | ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-]) | ||
| + | * inchi-key: | ||
| + | ** rruvjgasjonmdy-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 466.341 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PDHam2hi]] | ||
| + | * [[PDHam2mi]] | ||
| + | * [[RXN-12508]] | ||
| + | * [[RXN-14037]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12583]] |
| + | * [[RXN-14037]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}} |
| + | {{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=466.341}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite 2-ALPHA-HYDROXYETHYL-THPP
- common-name:
- 2-(α-hydroxyethyl)thiamine diphosphate
- smiles:
- cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
- inchi-key:
- rruvjgasjonmdy-uhfffaoysa-l
- molecular-weight:
- 466.341
