Difference between revisions of "CPD-3709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-GLUCURONOLACTONE == * common-name: ** d-glucurono-6,3-lactone * smiles: ** c1(=o)(c(o)c(o)[ch](c(o)c=o)o1) * inchi-key: ** uyuxsradsppk...") |
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3709 == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanosine 2',3'-cyclic monophosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uasryodfrywbrc-uuokfmhzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 344.2 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12058]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanosine 2',3'-cyclic monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=344.2}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-3709
- common-name:
- guanosine 2',3'-cyclic monophosphate
- smiles:
- c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
- inchi-key:
- uasryodfrywbrc-uuokfmhzsa-m
- molecular-weight:
- 344.2
