|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ07665 == | + | == Metabolite CPD-3709 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** guanosine 2',3'-cyclic monophosphate |
| − | * right-end-position: | + | * smiles: |
| − | ** 198751 | + | ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34))) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 179273 | + | ** uasryodfrywbrc-uuokfmhzsa-m |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 39.95805 | + | ** 344.2 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]] | + | * [[RXN-12058]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | * [[GAPDH_]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=guanosine 2',3'-cyclic monophosphate}} |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}} |
| − | * [[GAPOXNPHOSPHN-RXN]]
| + | {{#set: molecular-weight=344.2}} |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[TRIOSEPISOMERIZATION-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[GLUCONEO-PWY]]
| |
| − | ** '''12''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[P124-PWY]]
| |
| − | ** '''12''' reactions found over '''15''' reactions in the full pathway
| |
| − | * [[P185-PWY]]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[P122-PWY]]
| |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY-5484]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-1042]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[GLYCOLYSIS]]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[ANAGLYCOLYSIS-PWY]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[SUCSYN-PWY]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY66-399]]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-6901]]
| |
| − | ** '''10''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7003]]
| |
| − | ** '''8''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[CALVIN-PWY]]
| |
| − | ** '''12''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[P341-PWY]]
| |
| − | ** '''6''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-6142]]
| |
| − | ** '''10''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY66-373]]
| |
| − | ** '''3''' reactions found over '''5''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=198751}} | |
| − | {{#set: left-end-position=179273}}
| |
| − | {{#set: centisome-position=39.95805 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=3}}
| |
| − | {{#set: nb pathway associated=16}}
| |
