Difference between revisions of "CPD-3709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-lysine == * common-name: ** a [protein]-l-lysine == Reaction(s) known to consume the compound == * RXN-15560 * [[RXN-15561]...") |
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3709 == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanosine 2',3'-cyclic monophosphate |
| + | * smiles: | ||
| + | ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34))) | ||
| + | * inchi-key: | ||
| + | ** uasryodfrywbrc-uuokfmhzsa-m | ||
| + | * molecular-weight: | ||
| + | ** 344.2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12058]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanosine 2',3'-cyclic monophosphate}} |
| + | {{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}} | ||
| + | {{#set: molecular-weight=344.2}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-3709
- common-name:
- guanosine 2',3'-cyclic monophosphate
- smiles:
- c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
- inchi-key:
- uasryodfrywbrc-uuokfmhzsa-m
- molecular-weight:
- 344.2
