Difference between revisions of "CPD-3709"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
(Created page with "Category:metabolite == Metabolite Protein-L-lysine == * common-name: ** a [protein]-l-lysine == Reaction(s) known to consume the compound == * RXN-15560 * [[RXN-15561]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11938 ==
+
== Metabolite Protein-L-lysine ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
+
** a [protein]-l-lysine
* smiles:
 
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** hhqooerqsfjgep-slwywoedsa-a
 
* molecular-weight:
 
** 805.885
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10965]]
+
* [[RXN-15560]]
* [[RXN-10975]]
+
* [[RXN-15561]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.4.24-RXN]]
+
* [[3.4.19.12-RXN]]
* [[RXN-10965]]
+
* [[RXN-13186]]
* [[RXN-10974]]
+
* [[RXN-8661]]
* [[RXN-10975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=a [protein]-l-lysine}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
 
{{#set: molecular-weight=805.885}}
 

Revision as of 13:10, 14 January 2021

Metabolite Protein-L-lysine

  • common-name:
    • a [protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.