Difference between revisions of "CPD-371"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,3)-bisphosphate * smiles: ** c1(o)(c(o)c(op([o-])([o-])=o)c(o)c(op(...") |
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-P-SERINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phospho-l-serine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bzqfbwgglxlepq-reohclbhsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 183.057 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PSERTRANSAM-RXN]] | ||
| + | * [[RXN0-5114]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PSERTRANSAM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phospho-l-serine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.057}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite 3-P-SERINE
- common-name:
- 3-phospho-l-serine
- smiles:
- c(op([o-])([o-])=o)c([n+])c(=o)[o-]
- inchi-key:
- bzqfbwgglxlepq-reohclbhsa-l
- molecular-weight:
- 183.057
