Difference between revisions of "CPD-3710"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13699 == * common-name: ** 3,22-dioxochol-4-en-24-oyl-coa * smiles: ** cc(c(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...")
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13699 ==
+
== Metabolite CPD-3710 ==
 
* common-name:
 
* common-name:
** 3,22-dioxochol-4-en-24-oyl-coa
+
** cytidine 2'-monophosphate
 
* smiles:
 
* smiles:
** cc(c(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
+
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
 
* inchi-key:
 
* inchi-key:
** muouyousqgffip-gdrspgqtsa-j
+
** yquakormlhpslz-xvfcmesisa-l
 
* molecular-weight:
 
* molecular-weight:
** 1132.017
+
** 321.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12710]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12059]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,22-dioxochol-4-en-24-oyl-coa}}
+
{{#set: common-name=cytidine 2'-monophosphate}}
{{#set: inchi-key=inchikey=muouyousqgffip-gdrspgqtsa-j}}
+
{{#set: inchi-key=inchikey=yquakormlhpslz-xvfcmesisa-l}}
{{#set: molecular-weight=1132.017}}
+
{{#set: molecular-weight=321.183}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-3710

  • common-name:
    • cytidine 2'-monophosphate
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
  • inchi-key:
    • yquakormlhpslz-xvfcmesisa-l
  • molecular-weight:
    • 321.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality