Difference between revisions of "CPD-3710"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.11-RXN 1.5.1.11-RXN] == * direction: ** left-to-right * common-name: ** d-octopine dehydrogen...")
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.11-RXN 1.5.1.11-RXN] ==
+
== Metabolite CPD-3710 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** d-octopine dehydrogenase
+
** cytidine 2'-monophosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.5.1.11 ec-1.5.1.11]
+
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
== Reaction formula ==
+
* inchi-key:
* 1 [[ARG]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRUVATE]][c] '''=>''' 1 [[CPD-309]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c]
+
** yquakormlhpslz-xvfcmesisa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ15888]]
+
** 321.183
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-12059]]
* [[PWY-7351]], pyruvate fermentation to opines: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7351 PWY-7351]
+
== Reaction(s) of unknown directionality ==
** '''1''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=cytidine 2'-monophosphate}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=yquakormlhpslz-xvfcmesisa-l}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=321.183}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16287 16287]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00562 R00562]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=d-octopine dehydrogenase}}
 
{{#set: ec-number=ec-1.5.1.11}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-3710

  • common-name:
    • cytidine 2'-monophosphate
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
  • inchi-key:
    • yquakormlhpslz-xvfcmesisa-l
  • molecular-weight:
    • 321.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality