Difference between revisions of "CPD-3710"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GDP-L-GALACTOSE == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c...") |
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3710 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cytidine 2'-monophosphate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yquakormlhpslz-xvfcmesisa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 321.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12059]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cytidine 2'-monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yquakormlhpslz-xvfcmesisa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=321.183}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-3710
- common-name:
- cytidine 2'-monophosphate
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
- inchi-key:
- yquakormlhpslz-xvfcmesisa-l
- molecular-weight:
- 321.183
