Difference between revisions of "CPD-3710"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** ybisuhxejdgad...") |
(Created page with "Category:metabolite == Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R == * common-name: ** (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-gluc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7873]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7873]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=(n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R
- common-name:
- (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r
