Difference between revisions of "CPD-3725"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Lignoceroyl-ACPs == * common-name: ** a lignoceroyl-[acp] == Reaction(s) known to consume the compound == * RXN-10059 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Lignoceroyl-ACPs ==
+
== Metabolite CPD-3725 ==
 
* common-name:
 
* common-name:
** a lignoceroyl-[acp]
+
** uridine 2'3'-cyclic monophosphate
 +
* smiles:
 +
** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
 +
* inchi-key:
 +
** hwdmhjdymfrxox-xvfcmesisa-m
 +
* molecular-weight:
 +
** 305.16
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10059]]
+
* [[RXN-12060]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-526]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a lignoceroyl-[acp]}}
+
{{#set: common-name=uridine 2'3'-cyclic monophosphate}}
 +
{{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}}
 +
{{#set: molecular-weight=305.16}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-3725

  • common-name:
    • uridine 2'3'-cyclic monophosphate
  • smiles:
    • c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
  • inchi-key:
    • hwdmhjdymfrxox-xvfcmesisa-m
  • molecular-weight:
    • 305.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality